C15H31NO4 — CID 163400778
4-hydroxy-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]butanamide (PubChem CID 163400778) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-hydroxy-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]butanamide.
| Compound Name | 4-hydroxy-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 163400778 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 4-hydroxy-N-[2-[2-(4-methylhexoxy)ethoxy]ethyl]butanamide |
| SMILES | CCC(C)CCCOCCOCCNC(=O)CCCO |
| InChI | InChI=1S/C15H31NO4/c1-3-14(2)6-5-10-19-12-13-20-11-8-16-15(18)7-4-9-17/h14,17H,3-13H2,1-2H3,(H,16,18) |
| InChIKey | GLWJBJUIFBLYID-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|