C17H39NO4S — CID 171540633
N-butyl-2-[2-[2-(4-methylhexoxy)ethoxy]ethoxy]acetamide;molecular hydrogen;sulfane (PubChem CID 171540633) has the molecular formula C17H39NO4S and a molecular weight of 353.57 g/mol. Its IUPAC name is N-butyl-2-[2-[2-(4-methylhexoxy)ethoxy]ethoxy]acetamide;molecular hydrogen;sulfane.
| Compound Name | N-butyl-2-[2-[2-(4-methylhexoxy)ethoxy]ethoxy]acetamide;molecular hydrogen;sulfane |
|---|---|
| PubChem CID | 171540633 |
| Molecular Formula | C17H39NO4S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | N-butyl-2-[2-[2-(4-methylhexoxy)ethoxy]ethoxy]acetamide;molecular hydrogen;sulfane |
| SMILES | CCCCNC(=O)COCCOCCOCCCC(C)CC.S.[H][H] |
| InChI | InChI=1S/C17H35NO4.H2S.H2/c1-4-6-9-18-17(19)15-22-14-13-21-12-11-20-10-7-8-16(3)5-2;;/h16H,4-15H2,1-3H3,(H,18,19);1H2;1H |
| InChIKey | NTDWIMKIOXAIBK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|