C20H41NO5 — CID 166012960
2-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethoxy]-N-(4-methylpentyl)acetamide (PubChem CID 166012960) has the molecular formula C20H41NO5 and a molecular weight of 375.55 g/mol. Its IUPAC name is 2-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethoxy]-N-(4-methylpentyl)acetamide.
| Compound Name | 2-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethoxy]-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 166012960 |
| Molecular Formula | C20H41NO5 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 2-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethoxy]-N-(4-methylpentyl)acetamide |
| SMILES | CC(C)CCCNC(=O)COCCOCCOCCOCCCC(C)C |
| InChI | InChI=1S/C20H41NO5/c1-18(2)7-5-9-21-20(22)17-26-16-15-25-14-13-24-12-11-23-10-6-8-19(3)4/h18-19H,5-17H2,1-4H3,(H,21,22) |
| InChIKey | AEHPBMMEPUSSPD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|