C20H41NO4 — CID 138727601
N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide (PubChem CID 138727601) has the molecular formula C20H41NO4 and a molecular weight of 359.55 g/mol. Its IUPAC name is N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 138727601 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide |
| SMILES | CC(C)CCCCCOCCOCCCCCNC(=O)COC(C)C |
| InChI | InChI=1S/C20H41NO4/c1-18(2)11-7-5-9-13-23-15-16-24-14-10-6-8-12-21-20(22)17-25-19(3)4/h18-19H,5-17H2,1-4H3,(H,21,22) |
| InChIKey | FHPWPUMCYJUYEK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|