C19H38N2O5 — CID 142616275
N-[5-[2-(5-acetamidopentoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide (PubChem CID 142616275) has the molecular formula C19H38N2O5 and a molecular weight of 374.52 g/mol. Its IUPAC name is N-[5-[2-(5-acetamidopentoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[5-[2-(5-acetamidopentoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 142616275 |
| Molecular Formula | C19H38N2O5 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N-[5-[2-(5-acetamidopentoxy)ethoxy]pentyl]-2-propan-2-yloxyacetamide |
| SMILES | CC(=O)NCCCCCOCCOCCCCCNC(=O)COC(C)C |
| InChI | InChI=1S/C19H38N2O5/c1-17(2)26-16-19(23)21-11-7-5-9-13-25-15-14-24-12-8-4-6-10-20-18(3)22/h17H,4-16H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | MMTOYJDSXLVNNH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|