C15H30N2O6 — CID 142616578
N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide (PubChem CID 142616578) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 142616578 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide |
| SMILES | CC(=O)NCCOCCOCCOCCNC(=O)COC(C)C |
| InChI | InChI=1S/C15H30N2O6/c1-13(2)23-12-15(19)17-5-7-21-9-11-22-10-8-20-6-4-16-14(3)18/h13H,4-12H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ICAIRTGGYXYBGJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|