C10H20N2O4 — CID 18674787
N-[2-[2-(2-acetamidoethoxy)ethoxy]ethyl]acetamide (PubChem CID 18674787) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-[2-[2-(2-acetamidoethoxy)ethoxy]ethyl]acetamide.
| Compound Name | N-[2-[2-(2-acetamidoethoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 18674787 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-[2-[2-(2-acetamidoethoxy)ethoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C10H20N2O4/c1-9(13)11-3-5-15-7-8-16-6-4-12-10(2)14/h3-8H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | BFEOXSZBXGCZOJ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|