C10H18N2O4 — CID 91082226
N-[2-(2-acetamidoethoxy)ethyl]-3-oxobutanamide (PubChem CID 91082226) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is N-[2-(2-acetamidoethoxy)ethyl]-3-oxobutanamide.
| Compound Name | N-[2-(2-acetamidoethoxy)ethyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 91082226 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-[2-(2-acetamidoethoxy)ethyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCCOCCNC(C)=O |
| InChI | InChI=1S/C10H18N2O4/c1-8(13)7-10(15)12-4-6-16-5-3-11-9(2)14/h3-7H2,1-2H3,(H,11,14)(H,12,15) |
| InChIKey | SCYKZFVSVSOWJK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|