C13H25FN2O5 — CID 164592894
3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-N-(2-fluoroethyl)propanamide (PubChem CID 164592894) has the molecular formula C13H25FN2O5 and a molecular weight of 308.35 g/mol. Its IUPAC name is 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-N-(2-fluoroethyl)propanamide.
| Compound Name | 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-N-(2-fluoroethyl)propanamide |
|---|---|
| PubChem CID | 164592894 |
| Molecular Formula | C13H25FN2O5 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]-N-(2-fluoroethyl)propanamide |
| SMILES | CC(=O)NCCOCCOCCOCCC(=O)NCCF |
| InChI | InChI=1S/C13H25FN2O5/c1-12(17)15-5-7-20-9-11-21-10-8-19-6-2-13(18)16-4-3-14/h2-11H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | KTLCUMHHQHXKAS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|