C16H31N3O5 — CID 167096270
N-[2-[2-[3-(2-acetamidoethylamino)-3-oxopropoxy]ethoxy]ethyl]-2,2-dimethylpropanamide (PubChem CID 167096270) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[2-[2-[3-(2-acetamidoethylamino)-3-oxopropoxy]ethoxy]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[2-[3-(2-acetamidoethylamino)-3-oxopropoxy]ethoxy]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 167096270 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[2-[2-[3-(2-acetamidoethylamino)-3-oxopropoxy]ethoxy]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)NCCNC(=O)CCOCCOCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H31N3O5/c1-13(20)17-6-7-18-14(21)5-9-23-11-12-24-10-8-19-15(22)16(2,3)4/h5-12H2,1-4H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | IEXDQBUKMWZFOI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|