C16H31NO5 — CID 163518990
N-[2-[2-[2-(5,5-dimethyl-3-oxohexoxy)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 163518990) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[2-[2-[2-(5,5-dimethyl-3-oxohexoxy)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | N-[2-[2-[2-(5,5-dimethyl-3-oxohexoxy)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 163518990 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-[2-[2-[2-(5,5-dimethyl-3-oxohexoxy)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOCCOCCOCCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H31NO5/c1-14(18)17-6-8-21-10-12-22-11-9-20-7-5-15(19)13-16(2,3)4/h5-13H2,1-4H3,(H,17,18) |
| InChIKey | HVWQEZMFBTWUSW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|