C20H40O5 — CID 176880291
1-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-5,5-dimethylhexan-3-one (PubChem CID 176880291) has the molecular formula C20H40O5 and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-5,5-dimethylhexan-3-one.
| Compound Name | 1-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-5,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 176880291 |
| Molecular Formula | C20H40O5 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 1-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethoxy]-5,5-dimethylhexan-3-one |
| SMILES | CC(C)(C)CCOCCOCCOCCOCCC(=O)CC(C)(C)C |
| InChI | InChI=1S/C20H40O5/c1-19(2,3)8-10-23-12-14-25-16-15-24-13-11-22-9-7-18(21)17-20(4,5)6/h7-17H2,1-6H3 |
| InChIKey | SWKNMFZFMAPFIQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|