C20H38O6 — CID 90137650
2-[2-[2-(4,4-dimethylpentanoyloxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate (PubChem CID 90137650) has the molecular formula C20H38O6 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[2-[2-(4,4-dimethylpentanoyloxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-[2-[2-(4,4-dimethylpentanoyloxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 90137650 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 2-[2-[2-(4,4-dimethylpentanoyloxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CCC(=O)OCCOCCOCCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C20H38O6/c1-19(2,3)9-7-17(21)25-15-13-23-11-12-24-14-16-26-18(22)8-10-20(4,5)6/h7-16H2,1-6H3 |
| InChIKey | YQOTYRHTZNQVPN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|