C15H31NO5 — CID 104562890
2-[2-(2-methoxyethoxy)ethoxy]ethyl 6-amino-4,4-dimethylhexanoate (PubChem CID 104562890) has the molecular formula C15H31NO5 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 6-amino-4,4-dimethylhexanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 6-amino-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 104562890 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 6-amino-4,4-dimethylhexanoate |
| SMILES | COCCOCCOCCOC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C15H31NO5/c1-15(2,6-7-16)5-4-14(17)21-13-12-20-11-10-19-9-8-18-3/h4-13,16H2,1-3H3 |
| InChIKey | VNDSTXKBTDWLON-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|