C16H32O6 — CID 58409057
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate (PubChem CID 58409057) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 58409057 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4,4-dimethylpentanoate |
| SMILES | COCCOCCOCCOCCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C16H32O6/c1-16(2,3)6-5-15(17)22-14-13-21-12-11-20-10-9-19-8-7-18-4/h5-14H2,1-4H3 |
| InChIKey | ODPNWDZSLOSCBL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|