C21H28O4 — CID 148869293
2-(2-naphthalen-2-yloxyethoxy)ethyl 4,4-dimethylpentanoate (PubChem CID 148869293) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-(2-naphthalen-2-yloxyethoxy)ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-(2-naphthalen-2-yloxyethoxy)ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 148869293 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-(2-naphthalen-2-yloxyethoxy)ethyl 4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CCC(=O)OCCOCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H28O4/c1-21(2,3)11-10-20(22)25-15-13-23-12-14-24-19-9-8-17-6-4-5-7-18(17)16-19/h4-9,16H,10-15H2,1-3H3 |
| InChIKey | PAVUFZUXCBFEQV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|