C17H21NOS — CID 65259756
2,2-dimethyl-5-naphthalen-2-yloxypentanethioamide (PubChem CID 65259756) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 2,2-dimethyl-5-naphthalen-2-yloxypentanethioamide.
| Compound Name | 2,2-dimethyl-5-naphthalen-2-yloxypentanethioamide |
|---|---|
| PubChem CID | 65259756 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2,2-dimethyl-5-naphthalen-2-yloxypentanethioamide |
| SMILES | CC(C)(CCCOc1ccc2ccccc2c1)C(N)=S |
| InChI | InChI=1S/C17H21NOS/c1-17(2,16(18)20)10-5-11-19-15-9-8-13-6-3-4-7-14(13)12-15/h3-4,6-9,12H,5,10-11H2,1-2H3,(H2,18,20) |
| InChIKey | OZBMBWSIDGZBAO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|