C14H21NOS — CID 65259553
2,2-dimethyl-5-(2-methylphenoxy)pentanethioamide (PubChem CID 65259553) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2-methylphenoxy)pentanethioamide.
| Compound Name | 2,2-dimethyl-5-(2-methylphenoxy)pentanethioamide |
|---|---|
| PubChem CID | 65259553 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2,2-dimethyl-5-(2-methylphenoxy)pentanethioamide |
| SMILES | Cc1ccccc1OCCCC(C)(C)C(N)=S |
| InChI | InChI=1S/C14H21NOS/c1-11-7-4-5-8-12(11)16-10-6-9-14(2,3)13(15)17/h4-5,7-8H,6,9-10H2,1-3H3,(H2,15,17) |
| InChIKey | CLCUWCMUWZVBRI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|