C12H19NO2S — CID 65259909
5-(furan-2-ylmethoxy)-2,2-dimethylpentanethioamide (PubChem CID 65259909) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-(furan-2-ylmethoxy)-2,2-dimethylpentanethioamide.
| Compound Name | 5-(furan-2-ylmethoxy)-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 65259909 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-(furan-2-ylmethoxy)-2,2-dimethylpentanethioamide |
| SMILES | CC(C)(CCCOCc1ccco1)C(N)=S |
| InChI | InChI=1S/C12H19NO2S/c1-12(2,11(13)16)6-4-7-14-9-10-5-3-8-15-10/h3,5,8H,4,6-7,9H2,1-2H3,(H2,13,16) |
| InChIKey | YZRREZYEYQPFEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|