C13H22N2O3 — CID 113307628
3-amino-N-[3-(furan-2-ylmethoxy)propyl]-2,2-dimethylpropanamide (PubChem CID 113307628) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-2,2-dimethylpropanamide.
| Compound Name | 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113307628 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CN)C(=O)NCCCOCc1ccco1 |
| InChI | InChI=1S/C13H22N2O3/c1-13(2,10-14)12(16)15-6-4-7-17-9-11-5-3-8-18-11/h3,5,8H,4,6-7,9-10,14H2,1-2H3,(H,15,16) |
| InChIKey | IHGVOMOBTSOMEL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|