C11H16ClNO3 — CID 61251673
3-chloro-N-[3-(furan-2-ylmethoxy)propyl]propanamide (PubChem CID 61251673) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-chloro-N-[3-(furan-2-ylmethoxy)propyl]propanamide.
| Compound Name | 3-chloro-N-[3-(furan-2-ylmethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 61251673 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-chloro-N-[3-(furan-2-ylmethoxy)propyl]propanamide |
| SMILES | O=C(CCCl)NCCCOCc1ccco1 |
| InChI | InChI=1S/C11H16ClNO3/c12-5-4-11(14)13-6-2-7-15-9-10-3-1-8-16-10/h1,3,8H,2,4-7,9H2,(H,13,14) |
| InChIKey | XCEZVXPRSQORBS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|