C18H22ClNO3 — CID 87002587
4-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]butanamide (PubChem CID 87002587) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]butanamide |
|---|---|
| PubChem CID | 87002587 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(furan-2-ylmethoxy)propyl]butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C18H22ClNO3/c19-16-9-7-15(8-10-16)4-1-6-18(21)20-11-3-12-22-14-17-5-2-13-23-17/h2,5,7-10,13H,1,3-4,6,11-12,14H2,(H,20,21) |
| InChIKey | WSIKLAHAPRZMCQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|