C18H22FNO4 — CID 86914819
3-(3-fluoro-4-methoxyphenyl)-N-[3-(furan-2-ylmethoxy)propyl]propanamide (PubChem CID 86914819) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-N-[3-(furan-2-ylmethoxy)propyl]propanamide.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-N-[3-(furan-2-ylmethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 86914819 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-N-[3-(furan-2-ylmethoxy)propyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCCCOCc2ccco2)cc1F |
| InChI | InChI=1S/C18H22FNO4/c1-22-17-7-5-14(12-16(17)19)6-8-18(21)20-9-3-10-23-13-15-4-2-11-24-15/h2,4-5,7,11-12H,3,6,8-10,13H2,1H3,(H,20,21) |
| InChIKey | DSIHYSMLTJVJRG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|