C16H20N2O4 — CID 24528840
1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methoxyphenyl)urea (PubChem CID 24528840) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 24528840 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCCCOCc1ccco1 |
| InChI | InChI=1S/C16H20N2O4/c1-20-15-8-3-2-7-14(15)18-16(19)17-9-5-10-21-12-13-6-4-11-22-13/h2-4,6-8,11H,5,9-10,12H2,1H3,(H2,17,18,19) |
| InChIKey | GTIMCGPAFRWOKX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|