C11H17N3O2 — CID 62267554
1-(3-aminopropyl)-3-(2-methoxyphenyl)urea (PubChem CID 62267554) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-(2-methoxyphenyl)urea.
| Compound Name | 1-(3-aminopropyl)-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 62267554 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 1-(3-aminopropyl)-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCCCN |
| InChI | InChI=1S/C11H17N3O2/c1-16-10-6-3-2-5-9(10)14-11(15)13-8-4-7-12/h2-3,5-6H,4,7-8,12H2,1H3,(H2,13,14,15) |
| InChIKey | FATOSJMQHZIEHV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|