C12H21Cl2N3O2 — CID 119405623
N-(3-aminopropyl)-2-(2-methoxyanilino)acetamide;dihydrochloride (PubChem CID 119405623) has the molecular formula C12H21Cl2N3O2 and a molecular weight of 310.22 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(2-methoxyanilino)acetamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(2-methoxyanilino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119405623 |
| Molecular Formula | C12H21Cl2N3O2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(3-aminopropyl)-2-(2-methoxyanilino)acetamide;dihydrochloride |
| SMILES | COc1ccccc1NCC(=O)NCCCN.Cl.Cl |
| InChI | InChI=1S/C12H19N3O2.2ClH/c1-17-11-6-3-2-5-10(11)15-9-12(16)14-8-4-7-13;;/h2-3,5-6,15H,4,7-9,13H2,1H3,(H,14,16);2*1H |
| InChIKey | BOQLJARIYDDLRD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|