C11H19Cl2N3O2 — CID 119382686
N-(2-aminoethyl)-2-(2-methoxyanilino)acetamide;dihydrochloride (PubChem CID 119382686) has the molecular formula C11H19Cl2N3O2 and a molecular weight of 296.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(2-methoxyanilino)acetamide;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-2-(2-methoxyanilino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119382686 |
| Molecular Formula | C11H19Cl2N3O2 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-(2-aminoethyl)-2-(2-methoxyanilino)acetamide;dihydrochloride |
| SMILES | COc1ccccc1NCC(=O)NCCN.Cl.Cl |
| InChI | InChI=1S/C11H17N3O2.2ClH/c1-16-10-5-3-2-4-9(10)14-8-11(15)13-7-6-12;;/h2-5,14H,6-8,12H2,1H3,(H,13,15);2*1H |
| InChIKey | KTZTVZVNCPUGNT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |