C11H18N2O — CID 94254161
N'-(2-methoxyphenyl)butane-1,4-diamine (PubChem CID 94254161) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)butane-1,4-diamine.
| Compound Name | N'-(2-methoxyphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 94254161 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N'-(2-methoxyphenyl)butane-1,4-diamine |
| SMILES | COc1ccccc1NCCCCN |
| InChI | InChI=1S/C11H18N2O/c1-14-11-7-3-2-6-10(11)13-9-5-4-8-12/h2-3,6-7,13H,4-5,8-9,12H2,1H3 |
| InChIKey | JZTSDQPDQJHFOY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|