C17H19Cl2NO2 — CID 54798108
N-[4-(2,4-dichlorophenoxy)butyl]-2-methoxyaniline (PubChem CID 54798108) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenoxy)butyl]-2-methoxyaniline.
| Compound Name | N-[4-(2,4-dichlorophenoxy)butyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 54798108 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[4-(2,4-dichlorophenoxy)butyl]-2-methoxyaniline |
| SMILES | COc1ccccc1NCCCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2NO2/c1-21-17-7-3-2-6-15(17)20-10-4-5-11-22-16-9-8-13(18)12-14(16)19/h2-3,6-9,12,20H,4-5,10-11H2,1H3 |
| InChIKey | FNRBWBGNEJAZLW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|