C16H15Cl3FNO — CID 54798338
3-chloro-N-[4-(2,4-dichlorophenoxy)butyl]-4-fluoroaniline (PubChem CID 54798338) has the molecular formula C16H15Cl3FNO and a molecular weight of 362.66 g/mol. Its IUPAC name is 3-chloro-N-[4-(2,4-dichlorophenoxy)butyl]-4-fluoroaniline.
| Compound Name | 3-chloro-N-[4-(2,4-dichlorophenoxy)butyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 54798338 |
| Molecular Formula | C16H15Cl3FNO |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-chloro-N-[4-(2,4-dichlorophenoxy)butyl]-4-fluoroaniline |
| SMILES | Fc1ccc(NCCCCOc2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl3FNO/c17-11-3-6-16(14(19)9-11)22-8-2-1-7-21-12-4-5-15(20)13(18)10-12/h3-6,9-10,21H,1-2,7-8H2 |
| InChIKey | MYRAWDWPIZFEQN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|