C22H29ClFNO — CID 54798275
3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-4-fluoroaniline (PubChem CID 54798275) has the molecular formula C22H29ClFNO and a molecular weight of 377.93 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-4-fluoroaniline.
| Compound Name | 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 54798275 |
| Molecular Formula | C22H29ClFNO |
| Molecular Weight | 377.93 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-4-fluoroaniline |
| SMILES | CC(C)(C)c1ccc(OCCNc2ccc(F)c(Cl)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H29ClFNO/c1-21(2,3)15-7-10-20(17(13-15)22(4,5)6)26-12-11-25-16-8-9-19(24)18(23)14-16/h7-10,13-14,25H,11-12H2,1-6H3 |
| InChIKey | FAMAHRVYFGWXJM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.93 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|