C29H37NO2 — CID 54801603
N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-phenylmethoxyaniline (PubChem CID 54801603) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-phenylmethoxyaniline.
| Compound Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 54801603 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-phenylmethoxyaniline |
| SMILES | CC(C)(C)c1ccc(OCCNc2cccc(OCc3ccccc3)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37NO2/c1-28(2,3)23-15-16-27(26(19-23)29(4,5)6)31-18-17-30-24-13-10-14-25(20-24)32-21-22-11-8-7-9-12-22/h7-16,19-20,30H,17-18,21H2,1-6H3 |
| InChIKey | WPWVNIKKQDAXBA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|