C26H39NO2 — CID 54800070
N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-(2-methylpropoxy)aniline (PubChem CID 54800070) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-(2-methylpropoxy)aniline.
| Compound Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-(2-methylpropoxy)aniline |
|---|---|
| PubChem CID | 54800070 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-(2-methylpropoxy)aniline |
| SMILES | CC(C)COc1ccccc1NCCOc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H39NO2/c1-19(2)18-29-24-12-10-9-11-22(24)27-15-16-28-23-14-13-20(25(3,4)5)17-21(23)26(6,7)8/h9-14,17,19,27H,15-16,18H2,1-8H3 |
| InChIKey | XNEZDEJVSOPWLC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|