C23H32ClNO — CID 54797157
3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-methylaniline (PubChem CID 54797157) has the molecular formula C23H32ClNO and a molecular weight of 373.97 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-methylaniline.
| Compound Name | 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 54797157 |
| Molecular Formula | C23H32ClNO |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-chloro-N-[2-(2,4-ditert-butylphenoxy)ethyl]-2-methylaniline |
| SMILES | Cc1c(Cl)cccc1NCCOc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C23H32ClNO/c1-16-19(24)9-8-10-20(16)25-13-14-26-21-12-11-17(22(2,3)4)15-18(21)23(5,6)7/h8-12,15,25H,13-14H2,1-7H3 |
| InChIKey | KUMMTTHUBAFPGX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|