C25H36ClNO3 — CID 54855738
N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,4-ditert-butylphenoxy)ethanamine (PubChem CID 54855738) has the molecular formula C25H36ClNO3 and a molecular weight of 434.02 g/mol. Its IUPAC name is N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,4-ditert-butylphenoxy)ethanamine.
| Compound Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,4-ditert-butylphenoxy)ethanamine |
|---|---|
| PubChem CID | 54855738 |
| Molecular Formula | C25H36ClNO3 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[(2-chloro-4,5-dimethoxyphenyl)methyl]-2-(2,4-ditert-butylphenoxy)ethanamine |
| SMILES | COc1cc(Cl)c(CNCCOc2ccc(C(C)(C)C)cc2C(C)(C)C)cc1OC |
| InChI | InChI=1S/C25H36ClNO3/c1-24(2,3)18-9-10-21(19(14-18)25(4,5)6)30-12-11-27-16-17-13-22(28-7)23(29-8)15-20(17)26/h9-10,13-15,27H,11-12,16H2,1-8H3 |
| InChIKey | VPTOGGZMSGUMRP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|