C30H39NO3 — CID 54800763
N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-(2-phenoxyethoxy)aniline (PubChem CID 54800763) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-(2-phenoxyethoxy)aniline.
| Compound Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-(2-phenoxyethoxy)aniline |
|---|---|
| PubChem CID | 54800763 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | N-[2-(2,4-ditert-butylphenoxy)ethyl]-3-(2-phenoxyethoxy)aniline |
| SMILES | CC(C)(C)c1ccc(OCCNc2cccc(OCCOc3ccccc3)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H39NO3/c1-29(2,3)23-15-16-28(27(21-23)30(4,5)6)34-18-17-31-24-11-10-14-26(22-24)33-20-19-32-25-12-8-7-9-13-25/h7-16,21-22,31H,17-20H2,1-6H3 |
| InChIKey | RPVFQQCZSZYIAX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|