C16H20N2O — CID 115377712
3-N,3-N-dimethyl-1-N-(2-phenoxyethyl)benzene-1,3-diamine (PubChem CID 115377712) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1-N-(2-phenoxyethyl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N-dimethyl-1-N-(2-phenoxyethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 115377712 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-N,3-N-dimethyl-1-N-(2-phenoxyethyl)benzene-1,3-diamine |
| SMILES | CN(C)c1cccc(NCCOc2ccccc2)c1 |
| InChI | InChI=1S/C16H20N2O/c1-18(2)15-8-6-7-14(13-15)17-11-12-19-16-9-4-3-5-10-16/h3-10,13,17H,11-12H2,1-2H3 |
| InChIKey | XPVPMQKDSIECEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|