C19H33NO — CID 63473970
1-(2,4-ditert-butylphenoxy)-N-methylbutan-2-amine (PubChem CID 63473970) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-(2,4-ditert-butylphenoxy)-N-methylbutan-2-amine.
| Compound Name | 1-(2,4-ditert-butylphenoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 63473970 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-(2,4-ditert-butylphenoxy)-N-methylbutan-2-amine |
| SMILES | CCC(COc1ccc(C(C)(C)C)cc1C(C)(C)C)NC |
| InChI | InChI=1S/C19H33NO/c1-9-15(20-8)13-21-17-11-10-14(18(2,3)4)12-16(17)19(5,6)7/h10-12,15,20H,9,13H2,1-8H3 |
| InChIKey | KBSLDMAPFFDXRJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |