C16H26O3S — CID 86639499
(2,4-ditert-butylphenyl) ethanesulfonate (PubChem CID 86639499) has the molecular formula C16H26O3S and a molecular weight of 298.45 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) ethanesulfonate.
| Compound Name | (2,4-ditert-butylphenyl) ethanesulfonate |
|---|---|
| PubChem CID | 86639499 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2,4-ditert-butylphenyl) ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H26O3S/c1-8-20(17,18)19-14-10-9-12(15(2,3)4)11-13(14)16(5,6)7/h9-11H,8H2,1-7H3 |
| InChIKey | SHDLRWIDAOOKTQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|