C42H63O3PS — CID 175673047
tris(2,4-ditert-butylphenoxy)-sulfanylidene-λ5-phosphane (PubChem CID 175673047) has the molecular formula C42H63O3PS and a molecular weight of 679.00 g/mol. Its IUPAC name is tris(2,4-ditert-butylphenoxy)-sulfanylidene-λ5-phosphane.
| Compound Name | tris(2,4-ditert-butylphenoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 175673047 |
| Molecular Formula | C42H63O3PS |
| Molecular Weight | 679.00 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | tris(2,4-ditert-butylphenoxy)-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)(C)c1ccc(OP(=S)(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H63O3PS/c1-37(2,3)28-19-22-34(31(25-28)40(10,11)12)43-46(47,44-35-23-20-29(38(4,5)6)26-32(35)41(13,14)15)45-36-24-21-30(39(7,8)9)27-33(36)42(16,17)18/h19-27H,1-18H3 |
| InChIKey | FROFRJMLQIAIBY-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.00 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|