C28H46O7P2 — CID 159327100
(2,4-ditert-butylphenyl) dihydrogen phosphate;(2,4-ditert-butylphenyl) dihydrogen phosphite (PubChem CID 159327100) has the molecular formula C28H46O7P2 and a molecular weight of 556.62 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) dihydrogen phosphate;(2,4-ditert-butylphenyl) dihydrogen phosphite.
| Compound Name | (2,4-ditert-butylphenyl) dihydrogen phosphate;(2,4-ditert-butylphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 159327100 |
| Molecular Formula | C28H46O7P2 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (2,4-ditert-butylphenyl) dihydrogen phosphate;(2,4-ditert-butylphenyl) dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccc(OP(=O)(O)O)c(C(C)(C)C)c1.CC(C)(C)c1ccc(OP(O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H23O4P.C14H23O3P/c1-13(2,3)10-7-8-12(18-19(15,16)17)11(9-10)14(4,5)6;1-13(2,3)10-7-8-12(17-18(15)16)11(9-10)14(4,5)6/h7-9H,1-6H3,(H2,15,16,17);7-9,15-16H,1-6H3 |
| InChIKey | LEMRFKCHOBRNKU-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|