C16H27OP — CID 19091733
(2,4-ditert-butylphenoxy)-dimethylphosphane (PubChem CID 19091733) has the molecular formula C16H27OP and a molecular weight of 266.36 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-dimethylphosphane.
| Compound Name | (2,4-ditert-butylphenoxy)-dimethylphosphane |
|---|---|
| PubChem CID | 19091733 |
| Molecular Formula | C16H27OP |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-dimethylphosphane |
| SMILES | CP(C)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H27OP/c1-15(2,3)12-9-10-14(17-18(7)8)13(11-12)16(4,5)6/h9-11H,1-8H3 |
| InChIKey | ZECYVOMSMHWPGM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|