C58H88O4P2 — CID 139718939
2-bis(2,4-ditert-butylphenoxy)phosphanylethyl-bis(2,4-ditert-butylphenoxy)phosphane (PubChem CID 139718939) has the molecular formula C58H88O4P2 and a molecular weight of 911.29 g/mol. Its IUPAC name is 2-bis(2,4-ditert-butylphenoxy)phosphanylethyl-bis(2,4-ditert-butylphenoxy)phosphane.
| Compound Name | 2-bis(2,4-ditert-butylphenoxy)phosphanylethyl-bis(2,4-ditert-butylphenoxy)phosphane |
|---|---|
| PubChem CID | 139718939 |
| Molecular Formula | C58H88O4P2 |
| Molecular Weight | 911.29 g/mol |
| Exact Mass | 910.62 |
| IUPAC Name | 2-bis(2,4-ditert-butylphenoxy)phosphanylethyl-bis(2,4-ditert-butylphenoxy)phosphane |
| SMILES | CC(C)(C)c1ccc(OP(CCP(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C58H88O4P2/c1-51(2,3)39-25-29-47(43(35-39)55(13,14)15)59-63(60-48-30-26-40(52(4,5)6)36-44(48)56(16,17)18)33-34-64(61-49-31-27-41(53(7,8)9)37-45(49)57(19,20)21)62-50-32-28-42(54(10,11)12)38-46(50)58(22,23)24/h25-32,35-38H,33-34H2,1-24H3 |
| InChIKey | HLPCYRJSHQSDHW-UHFFFAOYSA-N |
| XLogP | 18.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.29 |
| LogP ≤ 5 | 18.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|