C15H25OP — CID 23594675
(2,4-ditert-butylphenoxy)-methylphosphane (PubChem CID 23594675) has the molecular formula C15H25OP and a molecular weight of 252.34 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-methylphosphane.
| Compound Name | (2,4-ditert-butylphenoxy)-methylphosphane |
|---|---|
| PubChem CID | 23594675 |
| Molecular Formula | C15H25OP |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-methylphosphane |
| SMILES | CPOc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C15H25OP/c1-14(2,3)11-8-9-13(16-17-7)12(10-11)15(4,5)6/h8-10,17H,1-7H3 |
| InChIKey | LQKXDQIDOJAGJT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|