C16H24O4 — CID 145055436
(2,4-ditert-butylphenoxy)methyl hydrogen carbonate (PubChem CID 145055436) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)methyl hydrogen carbonate.
| Compound Name | (2,4-ditert-butylphenoxy)methyl hydrogen carbonate |
|---|---|
| PubChem CID | 145055436 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2,4-ditert-butylphenoxy)methyl hydrogen carbonate |
| SMILES | CC(C)(C)c1ccc(OCOC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H24O4/c1-15(2,3)11-7-8-13(19-10-20-14(17)18)12(9-11)16(4,5)6/h7-9H,10H2,1-6H3,(H,17,18) |
| InChIKey | PZAUSNYAOJUOOP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|