C16H25NO — CID 134462410
2-(2,4-ditert-butylphenyl)acetamide (PubChem CID 134462410) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenyl)acetamide.
| Compound Name | 2-(2,4-ditert-butylphenyl)acetamide |
|---|---|
| PubChem CID | 134462410 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-(2,4-ditert-butylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(CC(N)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H25NO/c1-15(2,3)12-8-7-11(9-14(17)18)13(10-12)16(4,5)6/h7-8,10H,9H2,1-6H3,(H2,17,18) |
| InChIKey | IHLHZWPGOLGYRB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |