C25H34O4 — CID 20985013
3-[4-[2-(2,4-ditert-butylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20985013) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 3-[4-[2-(2,4-ditert-butylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-(2,4-ditert-butylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20985013 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 3-[4-[2-(2,4-ditert-butylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)c1ccc(OCCOc2ccc(CCC(=O)O)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34O4/c1-24(2,3)19-10-13-22(21(17-19)25(4,5)6)29-16-15-28-20-11-7-18(8-12-20)9-14-23(26)27/h7-8,10-13,17H,9,14-16H2,1-6H3,(H,26,27) |
| InChIKey | PXMZYEQWUUXLIP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|