C52H72O3 — CID 102176985
3-[4-[tris(3,5-ditert-butylphenyl)methyl]phenoxy]propanoic acid (PubChem CID 102176985) has the molecular formula C52H72O3 and a molecular weight of 745.14 g/mol. Its IUPAC name is 3-[4-[tris(3,5-ditert-butylphenyl)methyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[tris(3,5-ditert-butylphenyl)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 102176985 |
| Molecular Formula | C52H72O3 |
| Molecular Weight | 745.14 g/mol |
| Exact Mass | 744.55 |
| IUPAC Name | 3-[4-[tris(3,5-ditert-butylphenyl)methyl]phenoxy]propanoic acid |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)cc(C(c2ccc(OCCC(=O)O)cc2)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C52H72O3/c1-46(2,3)35-25-36(47(4,5)6)29-41(28-35)52(34-19-21-44(22-20-34)55-24-23-45(53)54,42-30-37(48(7,8)9)26-38(31-42)49(10,11)12)43-32-39(50(13,14)15)27-40(33-43)51(16,17)18/h19-22,25-33H,23-24H2,1-18H3,(H,53,54) |
| InChIKey | FJBHWXSMLJNIEN-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.14 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|