3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid

C20H24O4 — CID 22687157

IUPAC3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid
SMILESCc1cc(C)c(C)c(OCCOc2ccc(CCC(=O)O)cc2)c1
InChIInChI=1S/C20H24O4/c1-14-12-15(2)16(3)19(13-14)24-11-10-23-18-7-4-17(5-8-18)6-9-20(21)22/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,21,22)
InChIKeyJFSFIKHLVKWUBH-UHFFFAOYSA-N
MW328.41 g/mol
LogP4.09
Rot. Bonds8

About 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid

3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 22687157) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid.

Molecular Properties

Compound Name3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid
PubChem CID22687157
Molecular FormulaC20H24O4
Molecular Weight328.41 g/mol
Exact Mass328.17
IUPAC Name3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid
SMILESCc1cc(C)c(C)c(OCCOc2ccc(CCC(=O)O)cc2)c1
InChIInChI=1S/C20H24O4/c1-14-12-15(2)16(3)19(13-14)24-11-10-23-18-7-4-17(5-8-18)6-9-20(21)22/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,21,22)
InChIKeyJFSFIKHLVKWUBH-UHFFFAOYSA-N
XLogP4.09
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.41
LogP ≤ 54.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid?
The IUPAC name of 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid (CID 22687157) is 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid?
The canonical SMILES for 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid is Cc1cc(C)c(C)c(OCCOc2ccc(CCC(=O)O)cc2)c1.
What is the InChIKey of 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid?
The InChIKey is JFSFIKHLVKWUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4/c1-14-12-15(2)16(3)19(13-14)24-11-10-23-18-7-4-17(5-8-18)6-9-20(21)22/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,21,22).
What are the key properties of 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid?
3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid has a molecular weight of 328.41 g/mol, XLogP of 4.09, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid is sourced from PubChem (CID 22687157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).