C20H24O4 — CID 22687157
3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 22687157) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22687157 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-[4-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(C)c(C)c(OCCOc2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H24O4/c1-14-12-15(2)16(3)19(13-14)24-11-10-23-18-7-4-17(5-8-18)6-9-20(21)22/h4-5,7-8,12-13H,6,9-11H2,1-3H3,(H,21,22) |
| InChIKey | JFSFIKHLVKWUBH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|