C20H24O6 — CID 22680504
3-[3-ethoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 22680504) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-[3-ethoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-ethoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22680504 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3-[3-ethoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | CCOc1cc(CCC(=O)O)ccc1OCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H24O6/c1-3-24-19-14-15(5-11-20(21)22)4-10-18(19)26-13-12-25-17-8-6-16(23-2)7-9-17/h4,6-10,14H,3,5,11-13H2,1-2H3,(H,21,22) |
| InChIKey | BGHLWVHWSRNOTK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|